C30H45NO4S — CID 46907281
N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]benzenesulfonamide (PubChem CID 46907281) has the molecular formula C30H45NO4S and a molecular weight of 515.76 g/mol. Its IUPAC name is N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]benzenesulfonamide.
| Compound Name | N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46907281 |
| Molecular Formula | C30H45NO4S |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]benzenesulfonamide |
| SMILES | C[C@H](CCCCNS(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2/C(=C/C=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C30H45NO4S/c1-22(9-6-7-18-31-36(34,35)27-11-4-3-5-12-27)28-15-16-29-24(10-8-17-30(28,29)2)14-13-23-19-25(32)21-26(33)20-23/h3-5,11-14,22,25-26,28-29,31-33H,6-10,15-21H2,1-2H3/b24-14+/t22-,25-,26-,28-,29+,30-/m1/s1 |
| InChIKey | CPQDZCFQOGZGHJ-YRWUNVRQSA-N |
| XLogP | 5.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|