C24H41NO4S — CID 46907196
N-[(4R)-4-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]methanesulfonamide (PubChem CID 46907196) has the molecular formula C24H41NO4S and a molecular weight of 439.66 g/mol. Its IUPAC name is N-[(4R)-4-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]methanesulfonamide.
| Compound Name | N-[(4R)-4-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]methanesulfonamide |
|---|---|
| PubChem CID | 46907196 |
| Molecular Formula | C24H41NO4S |
| Molecular Weight | 439.66 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | N-[(4R)-4-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]methanesulfonamide |
| SMILES | C[C@H](CCCNS(C)(=O)=O)[C@H]1CC[C@H]2/C(=C/C=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C24H41NO4S/c1-17(6-5-13-25-30(3,28)29)22-10-11-23-19(7-4-12-24(22,23)2)9-8-18-14-20(26)16-21(27)15-18/h8-9,17,20-23,25-27H,4-7,10-16H2,1-3H3/b19-9+/t17-,20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | TVAROYXAOROOPW-PGPDLQSMSA-N |
| XLogP | 3.93 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|