C24H28N4O — CID 46908101
N-[[4-(4,4-dimethylpiperidin-1-yl)phenyl]methyl]-2-methyl-1,8-naphthyridine-3-carboxamide (PubChem CID 46908101) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[[4-(4,4-dimethylpiperidin-1-yl)phenyl]methyl]-2-methyl-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[[4-(4,4-dimethylpiperidin-1-yl)phenyl]methyl]-2-methyl-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 46908101 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-[[4-(4,4-dimethylpiperidin-1-yl)phenyl]methyl]-2-methyl-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1nc2ncccc2cc1C(=O)NCc1ccc(N2CCC(C)(C)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O/c1-17-21(15-19-5-4-12-25-22(19)27-17)23(29)26-16-18-6-8-20(9-7-18)28-13-10-24(2,3)11-14-28/h4-9,12,15H,10-11,13-14,16H2,1-3H3,(H,26,29) |
| InChIKey | LBHLFSFXQZXECA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|