C28H59NO6Ti+4 — CID 46908856
tetrakis(butan-1-ol);2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]phenol;titanium(4+) (PubChem CID 46908856) has the molecular formula C28H59NO6Ti+4 and a molecular weight of 553.65 g/mol. Its IUPAC name is tetrakis(butan-1-ol);2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]phenol;titanium(4+).
| Compound Name | tetrakis(butan-1-ol);2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]phenol;titanium(4+) |
|---|---|
| PubChem CID | 46908856 |
| Molecular Formula | C28H59NO6Ti+4 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.38 |
| IUPAC Name | tetrakis(butan-1-ol);2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]phenol;titanium(4+) |
| SMILES | CC(C)[C@@H](CO)NCc1ccccc1O.CCCCO.CCCCO.CCCCO.CCCCO.[Ti+4] |
| InChI | InChI=1S/C12H19NO2.4C4H10O.Ti/c1-9(2)11(8-14)13-7-10-5-3-4-6-12(10)15;4*1-2-3-4-5;/h3-6,9,11,13-15H,7-8H2,1-2H3;4*5H,2-4H2,1H3;/q;;;;;+4/t11-;;;;;/m1...../s1 |
| InChIKey | NBFBIUSYSAFEEF-ZSCZXJKCSA-N |
| XLogP | 4.61 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|