C24H18N2O5S — CID 46910446
N-[(5E)-2-(1,3-benzodioxol-5-yl)-5-benzylidene-4-oxo-1,3-thiazolidin-3-yl]-2-hydroxybenzamide (PubChem CID 46910446) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is N-[(5E)-2-(1,3-benzodioxol-5-yl)-5-benzylidene-4-oxo-1,3-thiazolidin-3-yl]-2-hydroxybenzamide.
| Compound Name | N-[(5E)-2-(1,3-benzodioxol-5-yl)-5-benzylidene-4-oxo-1,3-thiazolidin-3-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 46910446 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[(5E)-2-(1,3-benzodioxol-5-yl)-5-benzylidene-4-oxo-1,3-thiazolidin-3-yl]-2-hydroxybenzamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2ccccc2)SC1c1ccc2c(c1)OCO2)c1ccccc1O |
| InChI | InChI=1S/C24H18N2O5S/c27-18-9-5-4-8-17(18)22(28)25-26-23(29)21(12-15-6-2-1-3-7-15)32-24(26)16-10-11-19-20(13-16)31-14-30-19/h1-13,24,27H,14H2,(H,25,28)/b21-12+ |
| InChIKey | USUKRNYDQLKDRX-CIAFOILYSA-N |
| XLogP | 4.08 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|