C23H44O7Si — CID 46910605
methyl (2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6S)-6-formyl-4,4-dimethoxyoxan-2-yl]-2,4-dimethylhexanoate (PubChem CID 46910605) has the molecular formula C23H44O7Si and a molecular weight of 460.68 g/mol. Its IUPAC name is methyl (2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6S)-6-formyl-4,4-dimethoxyoxan-2-yl]-2,4-dimethylhexanoate.
| Compound Name | methyl (2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6S)-6-formyl-4,4-dimethoxyoxan-2-yl]-2,4-dimethylhexanoate |
|---|---|
| PubChem CID | 46910605 |
| Molecular Formula | C23H44O7Si |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | methyl (2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6S)-6-formyl-4,4-dimethoxyoxan-2-yl]-2,4-dimethylhexanoate |
| SMILES | COC(=O)[C@@H](C)C[C@H](C)[C@H](C[C@H]1CC(OC)(OC)C[C@@H](C=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O7Si/c1-16(11-17(2)21(25)26-6)20(30-31(9,10)22(3,4)5)12-18-13-23(27-7,28-8)14-19(15-24)29-18/h15-20H,11-14H2,1-10H3/t16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | DSYAJYXEMYWITH-HVTWWXFQSA-N |
| XLogP | 4.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|