C22H29ClN6 — CID 46913318
N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-4-chlorobenzo[g]phthalazin-1-amine (PubChem CID 46913318) has the molecular formula C22H29ClN6 and a molecular weight of 412.97 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-4-chlorobenzo[g]phthalazin-1-amine.
| Compound Name | N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-4-chlorobenzo[g]phthalazin-1-amine |
|---|---|
| PubChem CID | 46913318 |
| Molecular Formula | C22H29ClN6 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]-4-chlorobenzo[g]phthalazin-1-amine |
| SMILES | NCCCN1CCN(CCCNc2nnc(Cl)c3cc4ccccc4cc23)CC1 |
| InChI | InChI=1S/C22H29ClN6/c23-21-19-15-17-5-1-2-6-18(17)16-20(19)22(27-26-21)25-8-4-10-29-13-11-28(12-14-29)9-3-7-24/h1-2,5-6,15-16H,3-4,7-14,24H2,(H,25,27) |
| InChIKey | UJKFLRZPOFZDKR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|