C15H24NO5P — CID 46914708
(1R)-1-[(2R,3R)-3-diethoxyphosphoryloxiran-2-yl]-2-(2-methylanilino)ethanol (PubChem CID 46914708) has the molecular formula C15H24NO5P and a molecular weight of 329.33 g/mol. Its IUPAC name is (1R)-1-[(2R,3R)-3-diethoxyphosphoryloxiran-2-yl]-2-(2-methylanilino)ethanol.
| Compound Name | (1R)-1-[(2R,3R)-3-diethoxyphosphoryloxiran-2-yl]-2-(2-methylanilino)ethanol |
|---|---|
| PubChem CID | 46914708 |
| Molecular Formula | C15H24NO5P |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (1R)-1-[(2R,3R)-3-diethoxyphosphoryloxiran-2-yl]-2-(2-methylanilino)ethanol |
| SMILES | CCOP(=O)(OCC)[C@H]1O[C@@H]1[C@H](O)CNc1ccccc1C |
| InChI | InChI=1S/C15H24NO5P/c1-4-19-22(18,20-5-2)15-14(21-15)13(17)10-16-12-9-7-6-8-11(12)3/h6-9,13-17H,4-5,10H2,1-3H3/t13-,14-,15-/m1/s1 |
| InChIKey | DQNUMVHWMAOVKG-RBSFLKMASA-N |
| XLogP | 2.76 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|