C19H28O3 — CID 46915472
(1'R,8'aR)-8'a-methyl-1'-propan-2-yl-6'-prop-2-enylspiro[1,3-dioxolane-2,3'-2,6,7,8-tetrahydro-1H-azulene]-5'-one (PubChem CID 46915472) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1'R,8'aR)-8'a-methyl-1'-propan-2-yl-6'-prop-2-enylspiro[1,3-dioxolane-2,3'-2,6,7,8-tetrahydro-1H-azulene]-5'-one.
| Compound Name | (1'R,8'aR)-8'a-methyl-1'-propan-2-yl-6'-prop-2-enylspiro[1,3-dioxolane-2,3'-2,6,7,8-tetrahydro-1H-azulene]-5'-one |
|---|---|
| PubChem CID | 46915472 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1'R,8'aR)-8'a-methyl-1'-propan-2-yl-6'-prop-2-enylspiro[1,3-dioxolane-2,3'-2,6,7,8-tetrahydro-1H-azulene]-5'-one |
| SMILES | C=CCC1CC[C@@]2(C)C(=CC1=O)C1(C[C@@H]2C(C)C)OCCO1 |
| InChI | InChI=1S/C19H28O3/c1-5-6-14-7-8-18(4)15(13(2)3)12-19(21-9-10-22-19)17(18)11-16(14)20/h5,11,13-15H,1,6-10,12H2,2-4H3/t14?,15-,18-/m1/s1 |
| InChIKey | IHQDDSUPTWYPBE-QTLYGJNZSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|