C25H28N2O4 — CID 46916516
[3-(4-carbamoyl-5-methylfuran-2-yl)phenyl] N-(6-phenylhexyl)carbamate (PubChem CID 46916516) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is [3-(4-carbamoyl-5-methylfuran-2-yl)phenyl] N-(6-phenylhexyl)carbamate.
| Compound Name | [3-(4-carbamoyl-5-methylfuran-2-yl)phenyl] N-(6-phenylhexyl)carbamate |
|---|---|
| PubChem CID | 46916516 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [3-(4-carbamoyl-5-methylfuran-2-yl)phenyl] N-(6-phenylhexyl)carbamate |
| SMILES | Cc1oc(-c2cccc(OC(=O)NCCCCCCc3ccccc3)c2)cc1C(N)=O |
| InChI | InChI=1S/C25H28N2O4/c1-18-22(24(26)28)17-23(30-18)20-13-9-14-21(16-20)31-25(29)27-15-8-3-2-5-10-19-11-6-4-7-12-19/h4,6-7,9,11-14,16-17H,2-3,5,8,10,15H2,1H3,(H2,26,28)(H,27,29) |
| InChIKey | BGVKGSQKNCQLDU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|