C15H18N2O7S2 — CID 46916926
2-aminobenzoic acid;N-(4-hydroxyphenyl)acetamide;sulfurothioic O-acid (PubChem CID 46916926) has the molecular formula C15H18N2O7S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-aminobenzoic acid;N-(4-hydroxyphenyl)acetamide;sulfurothioic O-acid.
| Compound Name | 2-aminobenzoic acid;N-(4-hydroxyphenyl)acetamide;sulfurothioic O-acid |
|---|---|
| PubChem CID | 46916926 |
| Molecular Formula | C15H18N2O7S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-aminobenzoic acid;N-(4-hydroxyphenyl)acetamide;sulfurothioic O-acid |
| SMILES | CC(=O)Nc1ccc(O)cc1.Nc1ccccc1C(=O)O.O=S(O)(O)=S |
| InChI | InChI=1S/C8H9NO2.C7H7NO2.H2O3S2/c1-6(10)9-7-2-4-8(11)5-3-7;8-6-4-2-1-3-5(6)7(9)10;1-5(2,3)4/h2-5,11H,1H3,(H,9,10);1-4H,8H2,(H,9,10);(H2,1,2,3,4) |
| InChIKey | ODWYAVCDMCQDEW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|