C22H21ClF3N3O3 — CID 46918073
(4Z)-8-chloro-4-methoxyimino-N-[4-(trifluoromethyl)phenyl]spiro[3H-chromene-2,4'-piperidine]-1'-carboxamide (PubChem CID 46918073) has the molecular formula C22H21ClF3N3O3 and a molecular weight of 467.88 g/mol. Its IUPAC name is (4Z)-8-chloro-4-methoxyimino-N-[4-(trifluoromethyl)phenyl]spiro[3H-chromene-2,4'-piperidine]-1'-carboxamide.
| Compound Name | (4Z)-8-chloro-4-methoxyimino-N-[4-(trifluoromethyl)phenyl]spiro[3H-chromene-2,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 46918073 |
| Molecular Formula | C22H21ClF3N3O3 |
| Molecular Weight | 467.88 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (4Z)-8-chloro-4-methoxyimino-N-[4-(trifluoromethyl)phenyl]spiro[3H-chromene-2,4'-piperidine]-1'-carboxamide |
| SMILES | CO/N=C1/CC2(CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2)Oc2c(Cl)cccc21 |
| InChI | InChI=1S/C22H21ClF3N3O3/c1-31-28-18-13-21(32-19-16(18)3-2-4-17(19)23)9-11-29(12-10-21)20(30)27-15-7-5-14(6-8-15)22(24,25)26/h2-8H,9-13H2,1H3,(H,27,30)/b28-18- |
| InChIKey | SZTGQCJNJYZYAL-VEILYXNESA-N |
| XLogP | 5.56 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.88 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|