C23H30N4O8S2 — CID 46926002
CID 46926002 (PubChem CID 46926002) has the molecular formula C23H30N4O8S2 and a molecular weight of 554.65 g/mol.
| Compound Name | CID 46926002 |
|---|---|
| PubChem CID | 46926002 |
| Molecular Formula | C23H30N4O8S2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | — |
| SMILES | COc1ccc([S+](=O)([O-])N2CCCN([S+](=O)([O-])c3ccc(OC)c(NC(C)=O)c3)CC2)cc1NC(C)=O |
| InChI | InChI=1S/C23H30N4O8S2/c1-16(28)24-20-14-18(6-8-22(20)34-3)36(30,31)26-10-5-11-27(13-12-26)37(32,33)19-7-9-23(35-4)21(15-19)25-17(2)29/h6-9,14-15H,5,10-13H2,1-4H3,(H2-2,24,25,28,29,30,31,32,33) |
| InChIKey | NYWRBAIQTTVESS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|