C21H24N3O6+ — CID 4692777
ethyl 2-[[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carbonyl]hydrazinylidene]propanoate (PubChem CID 4692777) has the molecular formula C21H24N3O6+ and a molecular weight of 414.44 g/mol. Its IUPAC name is ethyl 2-[[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carbonyl]hydrazinylidene]propanoate.
| Compound Name | ethyl 2-[[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carbonyl]hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 4692777 |
| Molecular Formula | C21H24N3O6+ |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 2-[[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carbonyl]hydrazinylidene]propanoate |
| SMILES | CCOC(=O)C(C)=NNC(=O)c1cc[n+](CC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H23N3O6/c1-5-30-21(27)14(2)22-23-20(26)15-8-10-24(11-9-15)13-17(25)16-6-7-18(28-3)19(12-16)29-4/h6-12H,5,13H2,1-4H3/p+1 |
| InChIKey | VHROWOJPCCSJHK-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|