C28H45N3O5 — CID 46929379
CID 46929379 (PubChem CID 46929379) has the molecular formula C28H45N3O5 and a molecular weight of 503.68 g/mol.
| Compound Name | CID 46929379 |
|---|---|
| PubChem CID | 46929379 |
| Molecular Formula | C28H45N3O5 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.34 |
| IUPAC Name | — |
| SMILES | CN1CCC(N2CCN(C(=O)CC3CCC4(CC3)OOC3(OO4)C4CC5CC(C4)CC3C5)CC2)CC1 |
| InChI | InChI=1S/C28H45N3O5/c1-29-8-4-25(5-9-29)30-10-12-31(13-11-30)26(32)19-20-2-6-27(7-3-20)33-35-28(36-34-27)23-15-21-14-22(17-23)18-24(28)16-21/h20-25H,2-19H2,1H3 |
| InChIKey | JUKNBUODTQJUNZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|