About CID 46929379
CID 46929379 (PubChem CID 46929379) has the molecular formula C28H45N3O5
and a molecular weight of 503.68 g/mol.
Molecular Properties
| Compound Name | CID 46929379 |
| PubChem CID | 46929379 |
| Molecular Formula | C28H45N3O5 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.34 |
| IUPAC Name | — |
| SMILES | CN1CCC(N2CCN(C(=O)CC3CCC4(CC3)OOC3(OO4)C4CC5CC(C4)CC3C5)CC2)CC1 |
| InChI | InChI=1S/C28H45N3O5/c1-29-8-4-25(5-9-29)30-10-12-31(13-11-30)26(32)19-20-2-6-27(7-3-20)33-35-28(36-34-27)23-15-21-14-22(17-23)18-24(28)16-21/h20-25H,2-19H2,1H3 |
| InChIKey | JUKNBUODTQJUNZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 46929379 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46929379?
The IUPAC name of CID 46929379 (CID 46929379) is not available.
What is the SMILES notation for CID 46929379?
The canonical SMILES for CID 46929379 is CN1CCC(N2CCN(C(=O)CC3CCC4(CC3)OOC3(OO4)C4CC5CC(C4)CC3C5)CC2)CC1.
What is the InChIKey of CID 46929379?
The InChIKey is JUKNBUODTQJUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H45N3O5/c1-29-8-4-25(5-9-29)30-10-12-31(13-11-30)26(32)19-20-2-6-27(7-3-20)33-35-28(36-34-27)23-15-21-14-22(17-23)18-24(28)16-21/h20-25H,2-19H2,1H3.
What are the key properties of CID 46929379?
CID 46929379 has a molecular weight of 503.68 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46929379 is sourced from PubChem (CID 46929379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).