C19H21Cl2N3O2S — CID 46936098
5-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-oxoethyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one (PubChem CID 46936098) has the molecular formula C19H21Cl2N3O2S and a molecular weight of 426.37 g/mol. Its IUPAC name is 5-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-oxoethyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one.
| Compound Name | 5-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-oxoethyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 46936098 |
| Molecular Formula | C19H21Cl2N3O2S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 5-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-2-oxoethyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
| SMILES | O=C1C=C2CN(CC(=O)N3CCN(c4cccc(Cl)c4Cl)CC3)CCC2S1 |
| InChI | InChI=1S/C19H21Cl2N3O2S/c20-14-2-1-3-15(19(14)21)23-6-8-24(9-7-23)17(25)12-22-5-4-16-13(11-22)10-18(26)27-16/h1-3,10,16H,4-9,11-12H2 |
| InChIKey | BPIACYOTXCWOHJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|