C23H21FN3O7PS — CID 46937396
(2R,3R,4S,5R)-2-(5-fluoro-4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3,4-diol (PubChem CID 46937396) has the molecular formula C23H21FN3O7PS and a molecular weight of 533.47 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(5-fluoro-4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(5-fluoro-4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46937396 |
| Molecular Formula | C23H21FN3O7PS |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (2R,3R,4S,5R)-2-(5-fluoro-4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3,4-diol |
| SMILES | Cc1cccc2c1OP(=O)(OC[C@H]1O[C@@H](n3cc(F)c4c(-c5ccsc5)ncnc43)[C@H](O)[C@@H]1O)OC2 |
| InChI | InChI=1S/C23H21FN3O7PS/c1-12-3-2-4-13-8-31-35(30,34-21(12)13)32-9-16-19(28)20(29)23(33-16)27-7-15(24)17-18(14-5-6-36-10-14)25-11-26-22(17)27/h2-7,10-11,16,19-20,23,28-29H,8-9H2,1H3/t16-,19-,20-,23-,35?/m1/s1 |
| InChIKey | GCKUTKZBYKOENA-PQGILRKESA-N |
| XLogP | 3.96 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|