C19H20ClN3 — CID 46940655
1-[(4-chloro-2,3,5,6-tetradeuteriophenyl)methyl]-2-[(3,3,4,4-tetradeuteriopyrrolidin-1-yl)methyl]benzimidazole (PubChem CID 46940655) has the molecular formula C19H20ClN3 and a molecular weight of 333.89 g/mol. Its IUPAC name is 1-[(4-chloro-2,3,5,6-tetradeuteriophenyl)methyl]-2-[(3,3,4,4-tetradeuteriopyrrolidin-1-yl)methyl]benzimidazole.
| Compound Name | 1-[(4-chloro-2,3,5,6-tetradeuteriophenyl)methyl]-2-[(3,3,4,4-tetradeuteriopyrrolidin-1-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 46940655 |
| Molecular Formula | C19H20ClN3 |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-[(4-chloro-2,3,5,6-tetradeuteriophenyl)methyl]-2-[(3,3,4,4-tetradeuteriopyrrolidin-1-yl)methyl]benzimidazole |
| SMILES | [2H]c1c([2H])c(Cn2c(CN3CC([2H])([2H])C([2H])([2H])C3)nc3ccccc32)c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C19H20ClN3/c20-16-9-7-15(8-10-16)13-23-18-6-2-1-5-17(18)21-19(23)14-22-11-3-4-12-22/h1-2,5-10H,3-4,11-14H2/i3D2,4D2,7D,8D,9D,10D |
| InChIKey | CJXAEXPPLWQRFR-WTFFRHDBSA-N |
| XLogP | 4.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |