C15H18N2O7 — CID 46943442
(2R,3R,4S,5R)-2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46943442) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46943442 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1cc(OC)cc(-c2noc([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)n2)c1 |
| InChI | InChI=1S/C15H18N2O7/c1-21-8-3-7(4-9(5-8)22-2)14-16-15(24-17-14)13-12(20)11(19)10(6-18)23-13/h3-5,10-13,18-20H,6H2,1-2H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | OTUBRPAQCQYYPW-FDYHWXHSSA-N |
| XLogP | -0.09 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |