C21H14F2N2O2 — CID 46943597
N-[(3,4-difluorophenyl)methyl]-3-pyridin-3-yl-1-benzofuran-7-carboxamide (PubChem CID 46943597) has the molecular formula C21H14F2N2O2 and a molecular weight of 364.35 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-3-pyridin-3-yl-1-benzofuran-7-carboxamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-3-pyridin-3-yl-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 46943597 |
| Molecular Formula | C21H14F2N2O2 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-3-pyridin-3-yl-1-benzofuran-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(F)c1)c1cccc2c(-c3cccnc3)coc12 |
| InChI | InChI=1S/C21H14F2N2O2/c22-18-7-6-13(9-19(18)23)10-25-21(26)16-5-1-4-15-17(12-27-20(15)16)14-3-2-8-24-11-14/h1-9,11-12H,10H2,(H,25,26) |
| InChIKey | YHFHAPDUFFXHSI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |