C20H25NO2 — CID 46944923
ethyl (2S)-2-(1,3-dihydrobenzo[f]isoindol-2-yl)-4-methylpentanoate (PubChem CID 46944923) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is ethyl (2S)-2-(1,3-dihydrobenzo[f]isoindol-2-yl)-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-(1,3-dihydrobenzo[f]isoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 46944923 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | ethyl (2S)-2-(1,3-dihydrobenzo[f]isoindol-2-yl)-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)N1Cc2cc3ccccc3cc2C1 |
| InChI | InChI=1S/C20H25NO2/c1-4-23-20(22)19(9-14(2)3)21-12-17-10-15-7-5-6-8-16(15)11-18(17)13-21/h5-8,10-11,14,19H,4,9,12-13H2,1-3H3/t19-/m0/s1 |
| InChIKey | RWGBRTJWJPIGCZ-IBGZPJMESA-N |
| XLogP | 4.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |