About methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate
methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate (PubChem CID 46946107) has the molecular formula C20H21NO3S3
and a molecular weight of 419.59 g/mol. Its IUPAC name is methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate |
| PubChem CID | 46946107 |
| Molecular Formula | C20H21NO3S3 |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)c1cc(-c2cccs2)sc1-c1cccs1 |
| InChI | InChI=1S/C20H21NO3S3/c1-12(2)10-14(20(23)24-3)21-19(22)13-11-17(15-6-4-8-25-15)27-18(13)16-7-5-9-26-16/h4-9,11-12,14H,10H2,1-3H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | ZWOGZLAIXKMJJE-AWEZNQCLSA-N |
| XLogP | 5.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate?
The IUPAC name of methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate (CID 46946107) is methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate.
What is the SMILES notation for methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate?
The canonical SMILES for methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate is COC(=O)[C@H](CC(C)C)NC(=O)c1cc(-c2cccs2)sc1-c1cccs1.
What is the InChIKey of methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate?
The InChIKey is ZWOGZLAIXKMJJE-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H21NO3S3/c1-12(2)10-14(20(23)24-3)21-19(22)13-11-17(15-6-4-8-25-15)27-18(13)16-7-5-9-26-16/h4-9,11-12,14H,10H2,1-3H3,(H,21,22)/t14-/m0/s1.
What are the key properties of methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate?
methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate has a molecular weight of 419.59 g/mol, XLogP of 5.52, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(2,5-dithiophen-2-ylthiophene-3-carbonyl)amino]-4-methylpentanoate is sourced from PubChem (CID 46946107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).