C21H28N4O2 — CID 46980830
2-[1-[(3-methoxy-4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]oxypyrazine (PubChem CID 46980830) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[1-[(3-methoxy-4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]oxypyrazine.
| Compound Name | 2-[1-[(3-methoxy-4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]oxypyrazine |
|---|---|
| PubChem CID | 46980830 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-[1-[(3-methoxy-4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]oxypyrazine |
| SMILES | COc1cc(CN2CCC(Oc3cnccn3)CC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H28N4O2/c1-26-20-14-17(4-5-19(20)25-10-2-3-11-25)16-24-12-6-18(7-13-24)27-21-15-22-8-9-23-21/h4-5,8-9,14-15,18H,2-3,6-7,10-13,16H2,1H3 |
| InChIKey | SHYNHOFPFFFSEB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|