C23H33N3O — CID 46982407
[1-[1-(6-ethyl-4-methylquinolin-2-yl)piperidin-4-yl]piperidin-3-yl]methanol (PubChem CID 46982407) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is [1-[1-(6-ethyl-4-methylquinolin-2-yl)piperidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[1-(6-ethyl-4-methylquinolin-2-yl)piperidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 46982407 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | [1-[1-(6-ethyl-4-methylquinolin-2-yl)piperidin-4-yl]piperidin-3-yl]methanol |
| SMILES | CCc1ccc2nc(N3CCC(N4CCCC(CO)C4)CC3)cc(C)c2c1 |
| InChI | InChI=1S/C23H33N3O/c1-3-18-6-7-22-21(14-18)17(2)13-23(24-22)25-11-8-20(9-12-25)26-10-4-5-19(15-26)16-27/h6-7,13-14,19-20,27H,3-5,8-12,15-16H2,1-2H3 |
| InChIKey | XOIORGKSMPLWDB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |