C20H30N4O — CID 46984424
(1R,9aR)-1-[[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 46984424) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is (1R,9aR)-1-[[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1R,9aR)-1-[[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 46984424 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (1R,9aR)-1-[[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | Cc1ccc2nc(CN(C)C[C@]3(O)CCCN4CCCC[C@@H]43)[nH]c2c1 |
| InChI | InChI=1S/C20H30N4O/c1-15-7-8-16-17(12-15)22-19(21-16)13-23(2)14-20(25)9-5-11-24-10-4-3-6-18(20)24/h7-8,12,18,25H,3-6,9-11,13-14H2,1-2H3,(H,21,22)/t18-,20-/m1/s1 |
| InChIKey | XVVHYEYJCRGPNK-UYAOXDASSA-N |
| XLogP | 2.68 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |