C15H19N5O2 — CID 56861217
N-methyl-N-[(6-methyl-1H-benzimidazol-2-yl)methyl]-6-oxopiperazine-2-carboxamide (PubChem CID 56861217) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-methyl-N-[(6-methyl-1H-benzimidazol-2-yl)methyl]-6-oxopiperazine-2-carboxamide.
| Compound Name | N-methyl-N-[(6-methyl-1H-benzimidazol-2-yl)methyl]-6-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 56861217 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-methyl-N-[(6-methyl-1H-benzimidazol-2-yl)methyl]-6-oxopiperazine-2-carboxamide |
| SMILES | Cc1ccc2nc(CN(C)C(=O)C3CNCC(=O)N3)[nH]c2c1 |
| InChI | InChI=1S/C15H19N5O2/c1-9-3-4-10-11(5-9)18-13(17-10)8-20(2)15(22)12-6-16-7-14(21)19-12/h3-5,12,16H,6-8H2,1-2H3,(H,17,18)(H,19,21) |
| InChIKey | BBTCBNDFPFYMLP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |