C16H17N3OS — CID 46986489
2-[3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]phenol (PubChem CID 46986489) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]phenol.
| Compound Name | 2-[3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]phenol |
|---|---|
| PubChem CID | 46986489 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]phenol |
| SMILES | Cc1nc(NCCCc2ccccc2O)c2ccsc2n1 |
| InChI | InChI=1S/C16H17N3OS/c1-11-18-15(13-8-10-21-16(13)19-11)17-9-4-6-12-5-2-3-7-14(12)20/h2-3,5,7-8,10,20H,4,6,9H2,1H3,(H,17,18,19) |
| InChIKey | DYSRADVFGBGXLP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|