C16H14F3N3S — CID 137431954
N-(3-phenylpropyl)-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 137431954) has the molecular formula C16H14F3N3S and a molecular weight of 337.37 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-phenylpropyl)-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137431954 |
| Molecular Formula | C16H14F3N3S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(3-phenylpropyl)-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1nc(NCCCc2ccccc2)c2ccsc2n1 |
| InChI | InChI=1S/C16H14F3N3S/c17-16(18,19)15-21-13(12-8-10-23-14(12)22-15)20-9-4-7-11-5-2-1-3-6-11/h1-3,5-6,8,10H,4,7,9H2,(H,20,21,22) |
| InChIKey | NFNCFBOBZABWJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|