C11H19N3O3S — CID 46988502
N-[2-(3-methylbutan-2-yl)pyrazol-3-yl]-2-methylsulfonylacetamide (PubChem CID 46988502) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-[2-(3-methylbutan-2-yl)pyrazol-3-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[2-(3-methylbutan-2-yl)pyrazol-3-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 46988502 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[2-(3-methylbutan-2-yl)pyrazol-3-yl]-2-methylsulfonylacetamide |
| SMILES | CC(C)C(C)n1nccc1NC(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C11H19N3O3S/c1-8(2)9(3)14-10(5-6-12-14)13-11(15)7-18(4,16)17/h5-6,8-9H,7H2,1-4H3,(H,13,15) |
| InChIKey | RNNMOSVYUAPZOQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |