C17H19N3O4 — CID 46994347
N-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethyl]-2-(2-methylprop-2-enoxy)benzamide (PubChem CID 46994347) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethyl]-2-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethyl]-2-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 46994347 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[2-(3,6-dioxo-1H-pyridazin-2-yl)ethyl]-2-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1ccccc1C(=O)NCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C17H19N3O4/c1-12(2)11-24-14-6-4-3-5-13(14)17(23)18-9-10-20-16(22)8-7-15(21)19-20/h3-8H,1,9-11H2,2H3,(H,18,23)(H,19,21) |
| InChIKey | OBDKRCBFYVUHTL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|