C20H19FN6O2 — CID 46996916
N-(2-ethyltriazol-4-yl)-2-[3-(5-fluoro-2-methoxyphenyl)indazol-1-yl]acetamide (PubChem CID 46996916) has the molecular formula C20H19FN6O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is N-(2-ethyltriazol-4-yl)-2-[3-(5-fluoro-2-methoxyphenyl)indazol-1-yl]acetamide.
| Compound Name | N-(2-ethyltriazol-4-yl)-2-[3-(5-fluoro-2-methoxyphenyl)indazol-1-yl]acetamide |
|---|---|
| PubChem CID | 46996916 |
| Molecular Formula | C20H19FN6O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(2-ethyltriazol-4-yl)-2-[3-(5-fluoro-2-methoxyphenyl)indazol-1-yl]acetamide |
| SMILES | CCn1ncc(NC(=O)Cn2nc(-c3cc(F)ccc3OC)c3ccccc32)n1 |
| InChI | InChI=1S/C20H19FN6O2/c1-3-27-22-11-18(24-27)23-19(28)12-26-16-7-5-4-6-14(16)20(25-26)15-10-13(21)8-9-17(15)29-2/h4-11H,3,12H2,1-2H3,(H,23,24,28) |
| InChIKey | OGAMMWFTPFAHSI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |