C11H26Cl2N2O2 — CID 47000643
2,6-dimethyl-4-piperidin-4-ylmorpholine;hydrate;dihydrochloride (PubChem CID 47000643) has the molecular formula C11H26Cl2N2O2 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2,6-dimethyl-4-piperidin-4-ylmorpholine;hydrate;dihydrochloride.
| Compound Name | 2,6-dimethyl-4-piperidin-4-ylmorpholine;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 47000643 |
| Molecular Formula | C11H26Cl2N2O2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2,6-dimethyl-4-piperidin-4-ylmorpholine;hydrate;dihydrochloride |
| SMILES | CC1CN(C2CCNCC2)CC(C)O1.Cl.Cl.O |
| InChI | InChI=1S/C11H22N2O.2ClH.H2O/c1-9-7-13(8-10(2)14-9)11-3-5-12-6-4-11;;;/h9-12H,3-8H2,1-2H3;2*1H;1H2 |
| InChIKey | SYYXYSXGKAHZLU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |