C34H43N3O3S2 — CID 4700303
11-[5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid (PubChem CID 4700303) has the molecular formula C34H43N3O3S2 and a molecular weight of 605.87 g/mol. Its IUPAC name is 11-[5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid.
| Compound Name | 11-[5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid |
|---|---|
| PubChem CID | 4700303 |
| Molecular Formula | C34H43N3O3S2 |
| Molecular Weight | 605.87 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 11-[5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2C23CC4CC(CC(C4)C2)C3)SC1=S |
| InChI | InChI=1S/C34H43N3O3S2/c38-30(39)14-10-5-3-1-2-4-6-11-15-36-32(40)29(42-33(36)41)19-27-23-37(28-12-8-7-9-13-28)35-31(27)34-20-24-16-25(21-34)18-26(17-24)22-34/h7-9,12-13,19,23-26H,1-6,10-11,14-18,20-22H2,(H,38,39) |
| InChIKey | KVZFFJOJHILNRX-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.87 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|