C14H15Cl2NO4 — CID 47004261
[2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] oxolane-2-carboxylate (PubChem CID 47004261) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] oxolane-2-carboxylate.
| Compound Name | [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 47004261 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] oxolane-2-carboxylate |
| SMILES | Cc1ccc(Cl)c(NC(=O)COC(=O)C2CCCO2)c1Cl |
| InChI | InChI=1S/C14H15Cl2NO4/c1-8-4-5-9(15)13(12(8)16)17-11(18)7-21-14(19)10-3-2-6-20-10/h4-5,10H,2-3,6-7H2,1H3,(H,17,18) |
| InChIKey | DLYWTISVPKXSJK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |