C16H22N2O4 — CID 47013899
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 6-methoxypyridine-3-carboxylate (PubChem CID 47013899) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 6-methoxypyridine-3-carboxylate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 6-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 47013899 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 6-methoxypyridine-3-carboxylate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC2CCCCC2C)cn1 |
| InChI | InChI=1S/C16H22N2O4/c1-11-5-3-4-6-13(11)18-14(19)10-22-16(20)12-7-8-15(21-2)17-9-12/h7-9,11,13H,3-6,10H2,1-2H3,(H,18,19) |
| InChIKey | ZUPXRHJJAJDKMK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |