C17H14N2O6 — CID 47025969
(E)-3-[4-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methoxy]-3-methoxyphenyl]prop-2-enoic acid (PubChem CID 47025969) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is (E)-3-[4-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methoxy]-3-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methoxy]-3-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 47025969 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (E)-3-[4-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methoxy]-3-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1OCc1noc(-c2ccco2)n1 |
| InChI | InChI=1S/C17H14N2O6/c1-22-14-9-11(5-7-16(20)21)4-6-12(14)24-10-15-18-17(25-19-15)13-3-2-8-23-13/h2-9H,10H2,1H3,(H,20,21)/b7-5+ |
| InChIKey | ORJOMVAGNCJDPF-FNORWQNLSA-N |
| XLogP | 3.02 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|