C17H22ClN3O2S — CID 47027496
5-chloro-1-methyl-N-[(1-phenylcyclohexyl)methyl]imidazole-4-sulfonamide (PubChem CID 47027496) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-[(1-phenylcyclohexyl)methyl]imidazole-4-sulfonamide.
| Compound Name | 5-chloro-1-methyl-N-[(1-phenylcyclohexyl)methyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 47027496 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-chloro-1-methyl-N-[(1-phenylcyclohexyl)methyl]imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCC2(c3ccccc3)CCCCC2)c1Cl |
| InChI | InChI=1S/C17H22ClN3O2S/c1-21-13-19-16(15(21)18)24(22,23)20-12-17(10-6-3-7-11-17)14-8-4-2-5-9-14/h2,4-5,8-9,13,20H,3,6-7,10-12H2,1H3 |
| InChIKey | CGSLUIWNISNXPE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |