C11H18ClN3O3S — CID 115359369
5-chloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylimidazole-4-sulfonamide (PubChem CID 115359369) has the molecular formula C11H18ClN3O3S and a molecular weight of 307.80 g/mol. Its IUPAC name is 5-chloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 115359369 |
| Molecular Formula | C11H18ClN3O3S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 5-chloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCC2(CO)CCCC2)c1Cl |
| InChI | InChI=1S/C11H18ClN3O3S/c1-15-8-13-10(9(15)12)19(17,18)14-6-11(7-16)4-2-3-5-11/h8,14,16H,2-7H2,1H3 |
| InChIKey | BYCWGYSFEQHYQF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |