C19H20N6O5 — CID 47033951
4-(6-nitro-3-pyridinyl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazine-1-carboxamide (PubChem CID 47033951) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is 4-(6-nitro-3-pyridinyl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(6-nitro-3-pyridinyl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 47033951 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-(6-nitro-3-pyridinyl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCOC2=O)c1)N1CCN(c2ccc([N+](=O)[O-])nc2)CC1 |
| InChI | InChI=1S/C19H20N6O5/c26-18(21-14-2-1-3-15(12-14)24-10-11-30-19(24)27)23-8-6-22(7-9-23)16-4-5-17(20-13-16)25(28)29/h1-5,12-13H,6-11H2,(H,21,26) |
| InChIKey | BWXTTWHTAXUCHI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|