C19H20ClN5O6 — CID 47040515
methyl 5-chloro-2-methoxy-4-[[4-(6-nitro-3-pyridinyl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 47040515) has the molecular formula C19H20ClN5O6 and a molecular weight of 449.85 g/mol. Its IUPAC name is methyl 5-chloro-2-methoxy-4-[[4-(6-nitro-3-pyridinyl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 5-chloro-2-methoxy-4-[[4-(6-nitro-3-pyridinyl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 47040515 |
| Molecular Formula | C19H20ClN5O6 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | methyl 5-chloro-2-methoxy-4-[[4-(6-nitro-3-pyridinyl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)c(NC(=O)N2CCN(c3ccc([N+](=O)[O-])nc3)CC2)cc1OC |
| InChI | InChI=1S/C19H20ClN5O6/c1-30-16-10-15(14(20)9-13(16)18(26)31-2)22-19(27)24-7-5-23(6-8-24)12-3-4-17(21-11-12)25(28)29/h3-4,9-11H,5-8H2,1-2H3,(H,22,27) |
| InChIKey | OPGQBEQFWAFJIN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|