C14H14N6OS — CID 47038916
1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(1H-pyrazol-5-ylmethyl)urea (PubChem CID 47038916) has the molecular formula C14H14N6OS and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(1H-pyrazol-5-ylmethyl)urea.
| Compound Name | 1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(1H-pyrazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 47038916 |
| Molecular Formula | C14H14N6OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(1H-pyrazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1ccn[nH]1)Nc1nnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C14H14N6OS/c21-13(15-9-11-6-7-16-18-11)17-14-20-19-12(22-14)8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,16,18)(H2,15,17,20,21) |
| InChIKey | WJRZKQXCVHIVAX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |