C18H22F2N4O4 — CID 47039464
1-[3-(difluoromethoxy)phenyl]-3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]urea (PubChem CID 47039464) has the molecular formula C18H22F2N4O4 and a molecular weight of 396.39 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]urea |
|---|---|
| PubChem CID | 47039464 |
| Molecular Formula | C18H22F2N4O4 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]urea |
| SMILES | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H22F2N4O4/c19-15(20)28-13-6-3-5-12(11-13)22-16(26)21-9-4-10-24-14(25)18(23-17(24)27)7-1-2-8-18/h3,5-6,11,15H,1-2,4,7-10H2,(H,23,27)(H2,21,22,26) |
| InChIKey | AYCKPCLMUJSXAP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|