C20H25N5O5 — CID 71895851
1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea (PubChem CID 71895851) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea.
| Compound Name | 1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 71895851 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
| SMILES | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C20H25N5O5/c26-16-20(7-1-2-8-20)23-18(28)25(16)10-4-9-21-17(27)22-14-5-3-6-15(13-14)24-11-12-30-19(24)29/h3,5-6,13H,1-2,4,7-12H2,(H,23,28)(H2,21,22,27) |
| InChIKey | CUPKRHQXLWYYJS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|