C18H23N3O4 — CID 47039960
butyl 4-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamoyl]amino]benzoate (PubChem CID 47039960) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is butyl 4-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamoyl]amino]benzoate.
| Compound Name | butyl 4-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 47039960 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | butyl 4-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]carbamoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)N(C)Cc2cc(C)on2)cc1 |
| InChI | InChI=1S/C18H23N3O4/c1-4-5-10-24-17(22)14-6-8-15(9-7-14)19-18(23)21(3)12-16-11-13(2)25-20-16/h6-9,11H,4-5,10,12H2,1-3H3,(H,19,23) |
| InChIKey | VOHHNCTVJIVHIS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|