C20H24FN3O2S — CID 47040954
N-[2-fluoro-5-(2-thiophen-2-ylethylcarbamoylamino)phenyl]cyclohexanecarboxamide (PubChem CID 47040954) has the molecular formula C20H24FN3O2S and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[2-fluoro-5-(2-thiophen-2-ylethylcarbamoylamino)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[2-fluoro-5-(2-thiophen-2-ylethylcarbamoylamino)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 47040954 |
| Molecular Formula | C20H24FN3O2S |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[2-fluoro-5-(2-thiophen-2-ylethylcarbamoylamino)phenyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCc1cccs1)Nc1ccc(F)c(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C20H24FN3O2S/c21-17-9-8-15(23-20(26)22-11-10-16-7-4-12-27-16)13-18(17)24-19(25)14-5-2-1-3-6-14/h4,7-9,12-14H,1-3,5-6,10-11H2,(H,24,25)(H2,22,23,26) |
| InChIKey | HVOFEUBBBRAIEG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |