About N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide (PubChem CID 47044394) has the molecular formula C22H24N4O3S
and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide.
Molecular Properties
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide |
| PubChem CID | 47044394 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide |
| SMILES | O=C(NCCNc1nc2ccccc2s1)C(=O)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C22H24N4O3S/c27-20(23-13-14-24-22-26-18-7-3-4-8-19(18)30-22)21(28)25-15-9-11-17(12-10-15)29-16-5-1-2-6-16/h3-4,7-12,16H,1-2,5-6,13-14H2,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | DOONGDIGQRPRQZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide?
The IUPAC name of N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide (CID 47044394) is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide.
What is the SMILES notation for N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide?
The canonical SMILES for N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide is O=C(NCCNc1nc2ccccc2s1)C(=O)Nc1ccc(OC2CCCC2)cc1.
What is the InChIKey of N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide?
The InChIKey is DOONGDIGQRPRQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O3S/c27-20(23-13-14-24-22-26-18-7-3-4-8-19(18)30-22)21(28)25-15-9-11-17(12-10-15)29-16-5-1-2-6-16/h3-4,7-12,16H,1-2,5-6,13-14H2,(H,23,27)(H,24,26)(H,25,28).
What are the key properties of N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide?
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide has a molecular weight of 424.53 g/mol, XLogP of 3.78, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide is sourced from PubChem (CID 47044394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).