C22H24N4O3S — CID 47044394
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide (PubChem CID 47044394) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide |
|---|---|
| PubChem CID | 47044394 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-(4-cyclopentyloxyphenyl)oxamide |
| SMILES | O=C(NCCNc1nc2ccccc2s1)C(=O)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C22H24N4O3S/c27-20(23-13-14-24-22-26-18-7-3-4-8-19(18)30-22)21(28)25-15-9-11-17(12-10-15)29-16-5-1-2-6-16/h3-4,7-12,16H,1-2,5-6,13-14H2,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | DOONGDIGQRPRQZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|