C24H31N3O3 — CID 47048242
1-(1,4-diphenylbutyl)-3-(3-morpholin-4-yl-3-oxopropyl)urea (PubChem CID 47048242) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-(1,4-diphenylbutyl)-3-(3-morpholin-4-yl-3-oxopropyl)urea.
| Compound Name | 1-(1,4-diphenylbutyl)-3-(3-morpholin-4-yl-3-oxopropyl)urea |
|---|---|
| PubChem CID | 47048242 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-(1,4-diphenylbutyl)-3-(3-morpholin-4-yl-3-oxopropyl)urea |
| SMILES | O=C(NCCC(=O)N1CCOCC1)NC(CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c28-23(27-16-18-30-19-17-27)14-15-25-24(29)26-22(21-11-5-2-6-12-21)13-7-10-20-8-3-1-4-9-20/h1-6,8-9,11-12,22H,7,10,13-19H2,(H2,25,26,29) |
| InChIKey | UICNLICMINAUOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |