C21H19ClN2O3 — CID 47049679
1-[(4-chlorophenyl)methyl]-1-cyclopropyl-3-(4-methyl-2-oxochromen-7-yl)urea (PubChem CID 47049679) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-cyclopropyl-3-(4-methyl-2-oxochromen-7-yl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-cyclopropyl-3-(4-methyl-2-oxochromen-7-yl)urea |
|---|---|
| PubChem CID | 47049679 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-cyclopropyl-3-(4-methyl-2-oxochromen-7-yl)urea |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)N(Cc3ccc(Cl)cc3)C3CC3)ccc12 |
| InChI | InChI=1S/C21H19ClN2O3/c1-13-10-20(25)27-19-11-16(6-9-18(13)19)23-21(26)24(17-7-8-17)12-14-2-4-15(22)5-3-14/h2-6,9-11,17H,7-8,12H2,1H3,(H,23,26) |
| InChIKey | ANTUIJPGOJGYRE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|