C16H17N5O3S — CID 47050444
1-[3-(furan-2-ylmethoxy)propyl]-3-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 47050444) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-3-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-3-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 47050444 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-3-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(NCCCOCc1ccco1)Nc1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C16H17N5O3S/c22-15(18-8-4-9-23-11-12-5-3-10-24-12)19-16-21-20-14(25-16)13-6-1-2-7-17-13/h1-3,5-7,10H,4,8-9,11H2,(H2,18,19,21,22) |
| InChIKey | UZTJLDIJKFZLNL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|