C18H20FN3O2S2 — CID 47051092
1-[2-fluoro-5-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(thiophen-2-ylmethylsulfanyl)ethyl]urea (PubChem CID 47051092) has the molecular formula C18H20FN3O2S2 and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-[2-fluoro-5-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(thiophen-2-ylmethylsulfanyl)ethyl]urea.
| Compound Name | 1-[2-fluoro-5-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(thiophen-2-ylmethylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 47051092 |
| Molecular Formula | C18H20FN3O2S2 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-[2-fluoro-5-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(thiophen-2-ylmethylsulfanyl)ethyl]urea |
| SMILES | O=C(NCCSCc1cccs1)Nc1cc(N2CCCC2=O)ccc1F |
| InChI | InChI=1S/C18H20FN3O2S2/c19-15-6-5-13(22-8-1-4-17(22)23)11-16(15)21-18(24)20-7-10-25-12-14-3-2-9-26-14/h2-3,5-6,9,11H,1,4,7-8,10,12H2,(H2,20,21,24) |
| InChIKey | ULHLSIIDEUKIDC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|